C24H19F3O2 — CID 11784245
[(1R)-1-anthracen-9-yl-2,2,2-trifluoroethyl] (1R,2R,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 11784245) has the molecular formula C24H19F3O2 and a molecular weight of 396.41 g/mol. Its IUPAC name is [(1R)-1-anthracen-9-yl-2,2,2-trifluoroethyl] (1R,2R,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | [(1R)-1-anthracen-9-yl-2,2,2-trifluoroethyl] (1R,2R,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 11784245 |
| Molecular Formula | C24H19F3O2 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | [(1R)-1-anthracen-9-yl-2,2,2-trifluoroethyl] (1R,2R,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(O[C@H](c1c2ccccc2cc2ccccc12)C(F)(F)F)[C@@H]1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C24H19F3O2/c25-24(26,27)22(29-23(28)20-12-14-9-10-17(20)11-14)21-18-7-3-1-5-15(18)13-16-6-2-4-8-19(16)21/h1-10,13-14,17,20,22H,11-12H2/t14-,17+,20-,22-/m1/s1 |
| InChIKey | FLTOBNYHAFEXMD-UVLUGAHPSA-N |
| XLogP | 6.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|