C13H16F4O3 — CID 59385655
(4,5,5,5-tetrafluoro-4-hydroxypentan-2-yl) bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 59385655) has the molecular formula C13H16F4O3 and a molecular weight of 296.26 g/mol. Its IUPAC name is (4,5,5,5-tetrafluoro-4-hydroxypentan-2-yl) bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (4,5,5,5-tetrafluoro-4-hydroxypentan-2-yl) bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 59385655 |
| Molecular Formula | C13H16F4O3 |
| Molecular Weight | 296.26 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | (4,5,5,5-tetrafluoro-4-hydroxypentan-2-yl) bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC(CC(O)(F)C(F)(F)F)OC(=O)C1CC2C=CC1C2 |
| InChI | InChI=1S/C13H16F4O3/c1-7(6-12(14,19)13(15,16)17)20-11(18)10-5-8-2-3-9(10)4-8/h2-3,7-10,19H,4-6H2,1H3 |
| InChIKey | OGQCAWKGDRNLDF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|