C8H13ClO2 — CID 11789753
2-[(E)-2-chloroethenyl]-2-propyl-1,3-dioxolane (PubChem CID 11789753) has the molecular formula C8H13ClO2 and a molecular weight of 176.64 g/mol. Its IUPAC name is 2-[(E)-2-chloroethenyl]-2-propyl-1,3-dioxolane.
| Compound Name | 2-[(E)-2-chloroethenyl]-2-propyl-1,3-dioxolane |
|---|---|
| PubChem CID | 11789753 |
| Molecular Formula | C8H13ClO2 |
| Molecular Weight | 176.64 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 2-[(E)-2-chloroethenyl]-2-propyl-1,3-dioxolane |
| SMILES | CCCC1(/C=C/Cl)OCCO1 |
| InChI | InChI=1S/C8H13ClO2/c1-2-3-8(4-5-9)10-6-7-11-8/h4-5H,2-3,6-7H2,1H3/b5-4+ |
| InChIKey | MLNGSDAGWDAVPD-SNAWJCMRSA-N |
| XLogP | 2.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.64 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |