About 1-phenylnaphthalene
1-phenylnaphthalene (PubChem CID 11795) has the molecular formula C16H12
and a molecular weight of 204.27 g/mol. Its IUPAC name is 1-phenylnaphthalene.
Molecular Properties
| Compound Name | 1-phenylnaphthalene |
| PubChem CID | 11795 |
| Molecular Formula | C16H12 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 1-phenylnaphthalene |
| SMILES | c1ccc(-c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C16H12/c1-2-7-13(8-3-1)16-12-6-10-14-9-4-5-11-15(14)16/h1-12H |
| InChIKey | IYDMICQAKLQHLA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-phenylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylnaphthalene?
The IUPAC name of 1-phenylnaphthalene (CID 11795) is 1-phenylnaphthalene.
What is the SMILES notation for 1-phenylnaphthalene?
The canonical SMILES for 1-phenylnaphthalene is c1ccc(-c2cccc3ccccc23)cc1.
What is the InChIKey of 1-phenylnaphthalene?
The InChIKey is IYDMICQAKLQHLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12/c1-2-7-13(8-3-1)16-12-6-10-14-9-4-5-11-15(14)16/h1-12H.
What are the key properties of 1-phenylnaphthalene?
1-phenylnaphthalene has a molecular weight of 204.27 g/mol, XLogP of 4.51, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylnaphthalene is sourced from PubChem (CID 11795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).