C25H22N6O2 — CID 11797291
2-[3-(1-cyano-2-oxo-2-phenylethylidene)-2,4,8,10-tetrazaspiro[5.5]undecan-9-ylidene]-3-oxo-3-phenylpropanenitrile (PubChem CID 11797291) has the molecular formula C25H22N6O2 and a molecular weight of 438.49 g/mol. Its IUPAC name is 2-[3-(1-cyano-2-oxo-2-phenylethylidene)-2,4,8,10-tetrazaspiro[5.5]undecan-9-ylidene]-3-oxo-3-phenylpropanenitrile.
| Compound Name | 2-[3-(1-cyano-2-oxo-2-phenylethylidene)-2,4,8,10-tetrazaspiro[5.5]undecan-9-ylidene]-3-oxo-3-phenylpropanenitrile |
|---|---|
| PubChem CID | 11797291 |
| Molecular Formula | C25H22N6O2 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 2-[3-(1-cyano-2-oxo-2-phenylethylidene)-2,4,8,10-tetrazaspiro[5.5]undecan-9-ylidene]-3-oxo-3-phenylpropanenitrile |
| SMILES | N#CC(C(=O)c1ccccc1)=C1NCC2(CN1)CNC(=C(C#N)C(=O)c1ccccc1)NC2 |
| InChI | InChI=1S/C25H22N6O2/c26-11-19(21(32)17-7-3-1-4-8-17)23-28-13-25(14-29-23)15-30-24(31-16-25)20(12-27)22(33)18-9-5-2-6-10-18/h1-10,28-31H,13-16H2/b23-19-,24-20- |
| InChIKey | MDIZWUDVXNFZHW-SRPFLQSCSA-N |
| XLogP | 1.59 |
| TPSA | 129.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|