C26H21N3O5 — CID 118001816
1-[(4-formylphenyl)methyl]-N-[2-(4-nitrophenyl)ethyl]-2-oxoquinoline-3-carboxamide (PubChem CID 118001816) has the molecular formula C26H21N3O5 and a molecular weight of 455.47 g/mol. Its IUPAC name is 1-[(4-formylphenyl)methyl]-N-[2-(4-nitrophenyl)ethyl]-2-oxoquinoline-3-carboxamide.
| Compound Name | 1-[(4-formylphenyl)methyl]-N-[2-(4-nitrophenyl)ethyl]-2-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 118001816 |
| Molecular Formula | C26H21N3O5 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 1-[(4-formylphenyl)methyl]-N-[2-(4-nitrophenyl)ethyl]-2-oxoquinoline-3-carboxamide |
| SMILES | O=Cc1ccc(Cn2c(=O)c(C(=O)NCCc3ccc([N+](=O)[O-])cc3)cc3ccccc32)cc1 |
| InChI | InChI=1S/C26H21N3O5/c30-17-20-7-5-19(6-8-20)16-28-24-4-2-1-3-21(24)15-23(26(28)32)25(31)27-14-13-18-9-11-22(12-10-18)29(33)34/h1-12,15,17H,13-14,16H2,(H,27,31) |
| InChIKey | VCAPASFULZUDND-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 111.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|