C29H26N2O4 — CID 118001876
N-[2-(4-ethylphenyl)ethyl]-1-[2-(4-formylphenyl)acetyl]-2-oxoquinoline-3-carboxamide (PubChem CID 118001876) has the molecular formula C29H26N2O4 and a molecular weight of 466.54 g/mol. Its IUPAC name is N-[2-(4-ethylphenyl)ethyl]-1-[2-(4-formylphenyl)acetyl]-2-oxoquinoline-3-carboxamide.
| Compound Name | N-[2-(4-ethylphenyl)ethyl]-1-[2-(4-formylphenyl)acetyl]-2-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 118001876 |
| Molecular Formula | C29H26N2O4 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | N-[2-(4-ethylphenyl)ethyl]-1-[2-(4-formylphenyl)acetyl]-2-oxoquinoline-3-carboxamide |
| SMILES | CCc1ccc(CCNC(=O)c2cc3ccccc3n(C(=O)Cc3ccc(C=O)cc3)c2=O)cc1 |
| InChI | InChI=1S/C29H26N2O4/c1-2-20-7-9-21(10-8-20)15-16-30-28(34)25-18-24-5-3-4-6-26(24)31(29(25)35)27(33)17-22-11-13-23(19-32)14-12-22/h3-14,18-19H,2,15-17H2,1H3,(H,30,34) |
| InChIKey | DKRNXWVZALTQPD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|