C12H12FNO3 — CID 118004703
6-ethynyl-5-[(2S,3S,5R)-3-fluoro-4-hydroxy-5-methyloxolan-2-yl]-1H-pyridin-2-one (PubChem CID 118004703) has the molecular formula C12H12FNO3 and a molecular weight of 237.23 g/mol. Its IUPAC name is 6-ethynyl-5-[(2S,3S,5R)-3-fluoro-4-hydroxy-5-methyloxolan-2-yl]-1H-pyridin-2-one.
| Compound Name | 6-ethynyl-5-[(2S,3S,5R)-3-fluoro-4-hydroxy-5-methyloxolan-2-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118004703 |
| Molecular Formula | C12H12FNO3 |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 6-ethynyl-5-[(2S,3S,5R)-3-fluoro-4-hydroxy-5-methyloxolan-2-yl]-1H-pyridin-2-one |
| SMILES | C#Cc1[nH]c(=O)ccc1[C@@H]1O[C@H](C)C(O)[C@@H]1F |
| InChI | InChI=1S/C12H12FNO3/c1-3-8-7(4-5-9(15)14-8)12-10(13)11(16)6(2)17-12/h1,4-6,10-12,16H,2H3,(H,14,15)/t6-,10+,11?,12+/m1/s1 |
| InChIKey | HITKXGQSZPUGQY-DTUFRQEHSA-N |
| XLogP | 0.51 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|