C29H36N2O6P+ — CID 11800590
2-[4-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl]piperazin-1-yl]ethoxy-hydroxy-oxophosphanium (PubChem CID 11800590) has the molecular formula C29H36N2O6P+ and a molecular weight of 539.59 g/mol. Its IUPAC name is 2-[4-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl]piperazin-1-yl]ethoxy-hydroxy-oxophosphanium.
| Compound Name | 2-[4-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl]piperazin-1-yl]ethoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 11800590 |
| Molecular Formula | C29H36N2O6P+ |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | 2-[4-[2-[bis(4-methoxyphenyl)-phenylmethoxy]ethyl]piperazin-1-yl]ethoxy-hydroxy-oxophosphanium |
| SMILES | COc1ccc(C(OCCN2CCN(CCO[P+](=O)O)CC2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C29H35N2O6P/c1-34-27-12-8-25(9-13-27)29(24-6-4-3-5-7-24,26-10-14-28(35-2)15-11-26)36-22-20-30-16-18-31(19-17-30)21-23-37-38(32)33/h3-15H,16-23H2,1-2H3/p+1 |
| InChIKey | PRHOVRRUHQGIFB-UHFFFAOYSA-O |
| XLogP | 4.30 |
| TPSA | 80.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|