C20H23ClN4O4S — CID 118023066
4-[[6-amino-4-(3-chlorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]methyl]-1-methylpiperazin-2-one (PubChem CID 118023066) has the molecular formula C20H23ClN4O4S and a molecular weight of 450.95 g/mol. Its IUPAC name is 4-[[6-amino-4-(3-chlorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]methyl]-1-methylpiperazin-2-one.
| Compound Name | 4-[[6-amino-4-(3-chlorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]methyl]-1-methylpiperazin-2-one |
|---|---|
| PubChem CID | 118023066 |
| Molecular Formula | C20H23ClN4O4S |
| Molecular Weight | 450.95 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 4-[[6-amino-4-(3-chlorophenyl)sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]methyl]-1-methylpiperazin-2-one |
| SMILES | CN1CCN(CC2CN(S(=O)(=O)c3cccc(Cl)c3)c3cc(N)ccc3O2)CC1=O |
| InChI | InChI=1S/C20H23ClN4O4S/c1-23-7-8-24(13-20(23)26)11-16-12-25(18-10-15(22)5-6-19(18)29-16)30(27,28)17-4-2-3-14(21)9-17/h2-6,9-10,16H,7-8,11-13,22H2,1H3 |
| InChIKey | WOAJJBIBTWQAAL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.95 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|