C27H29FN4O3S — CID 118023413
N-[1-[3-(azetidin-1-yl)-4-benzyl-3,4-dihydro-2H-chromen-6-yl]azetidin-3-yl]-2-fluoropyridine-3-sulfonamide (PubChem CID 118023413) has the molecular formula C27H29FN4O3S and a molecular weight of 508.62 g/mol. Its IUPAC name is N-[1-[3-(azetidin-1-yl)-4-benzyl-3,4-dihydro-2H-chromen-6-yl]azetidin-3-yl]-2-fluoropyridine-3-sulfonamide.
| Compound Name | N-[1-[3-(azetidin-1-yl)-4-benzyl-3,4-dihydro-2H-chromen-6-yl]azetidin-3-yl]-2-fluoropyridine-3-sulfonamide |
|---|---|
| PubChem CID | 118023413 |
| Molecular Formula | C27H29FN4O3S |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | N-[1-[3-(azetidin-1-yl)-4-benzyl-3,4-dihydro-2H-chromen-6-yl]azetidin-3-yl]-2-fluoropyridine-3-sulfonamide |
| SMILES | O=S(=O)(NC1CN(c2ccc3c(c2)C(Cc2ccccc2)C(N2CCC2)CO3)C1)c1cccnc1F |
| InChI | InChI=1S/C27H29FN4O3S/c28-27-26(8-4-11-29-27)36(33,34)30-20-16-32(17-20)21-9-10-25-23(15-21)22(14-19-6-2-1-3-7-19)24(18-35-25)31-12-5-13-31/h1-4,6-11,15,20,22,24,30H,5,12-14,16-18H2 |
| InChIKey | XEJCQANOOAUWRK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|