C17H18F6N2O3 — CID 118023457
[(5S,6R)-6-methyl-2-oxo-5-phenyl-1-(2,2,2-trifluoroethyl)piperidin-3-yl]-(2,2,2-trifluoroethyl)carbamic acid (PubChem CID 118023457) has the molecular formula C17H18F6N2O3 and a molecular weight of 412.33 g/mol. Its IUPAC name is [(5S,6R)-6-methyl-2-oxo-5-phenyl-1-(2,2,2-trifluoroethyl)piperidin-3-yl]-(2,2,2-trifluoroethyl)carbamic acid.
| Compound Name | [(5S,6R)-6-methyl-2-oxo-5-phenyl-1-(2,2,2-trifluoroethyl)piperidin-3-yl]-(2,2,2-trifluoroethyl)carbamic acid |
|---|---|
| PubChem CID | 118023457 |
| Molecular Formula | C17H18F6N2O3 |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | [(5S,6R)-6-methyl-2-oxo-5-phenyl-1-(2,2,2-trifluoroethyl)piperidin-3-yl]-(2,2,2-trifluoroethyl)carbamic acid |
| SMILES | C[C@@H]1[C@H](c2ccccc2)CC(N(CC(F)(F)F)C(=O)O)C(=O)N1CC(F)(F)F |
| InChI | InChI=1S/C17H18F6N2O3/c1-10-12(11-5-3-2-4-6-11)7-13(14(26)24(10)8-16(18,19)20)25(15(27)28)9-17(21,22)23/h2-6,10,12-13H,7-9H2,1H3,(H,27,28)/t10-,12-,13?/m1/s1 |
| InChIKey | MNYLSPVQPGNXNV-HLVWMGJTSA-N |
| XLogP | 3.86 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |