C17H16ClN5O4S2 — CID 118025692
2-(6-chloro-1,3-benzothiazol-2-yl)-1-(2-nitrophenyl)sulfonylpyrrolidine-3,4-diamine (PubChem CID 118025692) has the molecular formula C17H16ClN5O4S2 and a molecular weight of 453.93 g/mol. Its IUPAC name is 2-(6-chloro-1,3-benzothiazol-2-yl)-1-(2-nitrophenyl)sulfonylpyrrolidine-3,4-diamine.
| Compound Name | 2-(6-chloro-1,3-benzothiazol-2-yl)-1-(2-nitrophenyl)sulfonylpyrrolidine-3,4-diamine |
|---|---|
| PubChem CID | 118025692 |
| Molecular Formula | C17H16ClN5O4S2 |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.03 |
| IUPAC Name | 2-(6-chloro-1,3-benzothiazol-2-yl)-1-(2-nitrophenyl)sulfonylpyrrolidine-3,4-diamine |
| SMILES | NC1CN(S(=O)(=O)c2ccccc2[N+](=O)[O-])C(c2nc3ccc(Cl)cc3s2)C1N |
| InChI | InChI=1S/C17H16ClN5O4S2/c18-9-5-6-11-13(7-9)28-17(21-11)16-15(20)10(19)8-22(16)29(26,27)14-4-2-1-3-12(14)23(24)25/h1-7,10,15-16H,8,19-20H2 |
| InChIKey | YNUBBHFYEAKXPP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 145.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|