C26H24ClN5O7S2 — CID 122438760
N-[(3S,4R)-4-[(6-chloro-1,3-benzothiazol-2-yl)amino]-1-(2-nitrophenyl)sulfonylpyrrolidin-3-yl]-2,6-dimethoxybenzamide (PubChem CID 122438760) has the molecular formula C26H24ClN5O7S2 and a molecular weight of 618.09 g/mol. Its IUPAC name is N-[(3S,4R)-4-[(6-chloro-1,3-benzothiazol-2-yl)amino]-1-(2-nitrophenyl)sulfonylpyrrolidin-3-yl]-2,6-dimethoxybenzamide.
| Compound Name | N-[(3S,4R)-4-[(6-chloro-1,3-benzothiazol-2-yl)amino]-1-(2-nitrophenyl)sulfonylpyrrolidin-3-yl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 122438760 |
| Molecular Formula | C26H24ClN5O7S2 |
| Molecular Weight | 618.09 g/mol |
| Exact Mass | 617.08 |
| IUPAC Name | N-[(3S,4R)-4-[(6-chloro-1,3-benzothiazol-2-yl)amino]-1-(2-nitrophenyl)sulfonylpyrrolidin-3-yl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)N[C@H]1CN(S(=O)(=O)c2ccccc2[N+](=O)[O-])C[C@H]1Nc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C26H24ClN5O7S2/c1-38-20-7-5-8-21(39-2)24(20)25(33)28-17-13-31(41(36,37)23-9-4-3-6-19(23)32(34)35)14-18(17)30-26-29-16-11-10-15(27)12-22(16)40-26/h3-12,17-18H,13-14H2,1-2H3,(H,28,33)(H,29,30)/t17-,18+/m0/s1 |
| InChIKey | YZUGUSAUWBYGHY-ZWKOTPCHSA-N |
| XLogP | 4.16 |
| TPSA | 153.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.09 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|