C20H38N4O6 — CID 118027495
2-[4,7-bis(carboxymethyl)-6,10-di(propan-2-yl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 118027495) has the molecular formula C20H38N4O6 and a molecular weight of 430.55 g/mol. Its IUPAC name is 2-[4,7-bis(carboxymethyl)-6,10-di(propan-2-yl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(carboxymethyl)-6,10-di(propan-2-yl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 118027495 |
| Molecular Formula | C20H38N4O6 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | 2-[4,7-bis(carboxymethyl)-6,10-di(propan-2-yl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CC(C)C1CN(CC(=O)O)CCN(CC(=O)O)CCN(C(C)C)CCN1CC(=O)O |
| InChI | InChI=1S/C20H38N4O6/c1-15(2)17-11-22(13-19(27)28)6-5-21(12-18(25)26)7-8-23(16(3)4)9-10-24(17)14-20(29)30/h15-17H,5-14H2,1-4H3,(H,25,26)(H,27,28)(H,29,30) |
| InChIKey | CLEJOZSQTPXGBX-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 124.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |