C19H25F3N2O3 — CID 118028742
tert-butyl N-[(5S,6R)-1-ethyl-6-methyl-2-oxo-5-(2,3,5-trifluorophenyl)piperidin-3-yl]carbamate (PubChem CID 118028742) has the molecular formula C19H25F3N2O3 and a molecular weight of 386.41 g/mol. Its IUPAC name is tert-butyl N-[(5S,6R)-1-ethyl-6-methyl-2-oxo-5-(2,3,5-trifluorophenyl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(5S,6R)-1-ethyl-6-methyl-2-oxo-5-(2,3,5-trifluorophenyl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 118028742 |
| Molecular Formula | C19H25F3N2O3 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | tert-butyl N-[(5S,6R)-1-ethyl-6-methyl-2-oxo-5-(2,3,5-trifluorophenyl)piperidin-3-yl]carbamate |
| SMILES | CCN1C(=O)C(NC(=O)OC(C)(C)C)C[C@@H](c2cc(F)cc(F)c2F)[C@H]1C |
| InChI | InChI=1S/C19H25F3N2O3/c1-6-24-10(2)12(13-7-11(20)8-14(21)16(13)22)9-15(17(24)25)23-18(26)27-19(3,4)5/h7-8,10,12,15H,6,9H2,1-5H3,(H,23,26)/t10-,12-,15?/m1/s1 |
| InChIKey | JPCQLYPOWQOVJN-VCQMFTIRSA-N |
| XLogP | 3.72 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|