C25H33F3N2O4 — CID 164842510
tert-butyl N-[(3S,5S,6R)-6-methyl-2-oxo-1-(3-pent-4-ynoxypropyl)-5-(2,3,6-trifluorophenyl)piperidin-3-yl]carbamate (PubChem CID 164842510) has the molecular formula C25H33F3N2O4 and a molecular weight of 482.54 g/mol. Its IUPAC name is tert-butyl N-[(3S,5S,6R)-6-methyl-2-oxo-1-(3-pent-4-ynoxypropyl)-5-(2,3,6-trifluorophenyl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,5S,6R)-6-methyl-2-oxo-1-(3-pent-4-ynoxypropyl)-5-(2,3,6-trifluorophenyl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 164842510 |
| Molecular Formula | C25H33F3N2O4 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | tert-butyl N-[(3S,5S,6R)-6-methyl-2-oxo-1-(3-pent-4-ynoxypropyl)-5-(2,3,6-trifluorophenyl)piperidin-3-yl]carbamate |
| SMILES | C#CCCCOCCCN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C[C@@H](c2c(F)ccc(F)c2F)[C@H]1C |
| InChI | InChI=1S/C25H33F3N2O4/c1-6-7-8-13-33-14-9-12-30-16(2)17(21-18(26)10-11-19(27)22(21)28)15-20(23(30)31)29-24(32)34-25(3,4)5/h1,10-11,16-17,20H,7-9,12-15H2,2-5H3,(H,29,32)/t16-,17-,20+/m1/s1 |
| InChIKey | SIKDTBBKTNGUJK-HLIPFELVSA-N |
| XLogP | 4.52 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|