C19H20F2N2O4 — CID 118037025
phenyl 6-(difluoromethyl)-7-(dimethoxymethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate (PubChem CID 118037025) has the molecular formula C19H20F2N2O4 and a molecular weight of 378.38 g/mol. Its IUPAC name is phenyl 6-(difluoromethyl)-7-(dimethoxymethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate.
| Compound Name | phenyl 6-(difluoromethyl)-7-(dimethoxymethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 118037025 |
| Molecular Formula | C19H20F2N2O4 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | phenyl 6-(difluoromethyl)-7-(dimethoxymethyl)-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate |
| SMILES | COC(OC)c1nc2c(cc1C(F)F)CCCN2C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C19H20F2N2O4/c1-25-18(26-2)15-14(16(20)21)11-12-7-6-10-23(17(12)22-15)19(24)27-13-8-4-3-5-9-13/h3-5,8-9,11,16,18H,6-7,10H2,1-2H3 |
| InChIKey | YQWJTPYXNRXPKL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|