C24H30N2O3 — CID 118047453
benzyl N-[1-[2-(4-methoxyphenyl)-6-azabicyclo[3.1.1]heptan-2-yl]propyl]carbamate (PubChem CID 118047453) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is benzyl N-[1-[2-(4-methoxyphenyl)-6-azabicyclo[3.1.1]heptan-2-yl]propyl]carbamate.
| Compound Name | benzyl N-[1-[2-(4-methoxyphenyl)-6-azabicyclo[3.1.1]heptan-2-yl]propyl]carbamate |
|---|---|
| PubChem CID | 118047453 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | benzyl N-[1-[2-(4-methoxyphenyl)-6-azabicyclo[3.1.1]heptan-2-yl]propyl]carbamate |
| SMILES | CCC(NC(=O)OCc1ccccc1)C1(c2ccc(OC)cc2)CCC2CC1N2 |
| InChI | InChI=1S/C24H30N2O3/c1-3-21(26-23(27)29-16-17-7-5-4-6-8-17)24(14-13-19-15-22(24)25-19)18-9-11-20(28-2)12-10-18/h4-12,19,21-22,25H,3,13-16H2,1-2H3,(H,26,27) |
| InChIKey | BVKAXZPFWMTIEP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |