C22H37NO7 — CID 118053347
[(3R,5S,6R)-5-methoxy-4-[(3R)-2-methyl-3-[(E)-3-methylbut-1-enyl]oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[2-(2-methoxyethoxy)ethyl]carbamate (PubChem CID 118053347) has the molecular formula C22H37NO7 and a molecular weight of 427.54 g/mol. Its IUPAC name is [(3R,5S,6R)-5-methoxy-4-[(3R)-2-methyl-3-[(E)-3-methylbut-1-enyl]oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[2-(2-methoxyethoxy)ethyl]carbamate.
| Compound Name | [(3R,5S,6R)-5-methoxy-4-[(3R)-2-methyl-3-[(E)-3-methylbut-1-enyl]oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[2-(2-methoxyethoxy)ethyl]carbamate |
|---|---|
| PubChem CID | 118053347 |
| Molecular Formula | C22H37NO7 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | [(3R,5S,6R)-5-methoxy-4-[(3R)-2-methyl-3-[(E)-3-methylbut-1-enyl]oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] N-[2-(2-methoxyethoxy)ethyl]carbamate |
| SMILES | COCCOCCNC(=O)O[C@@H]1CC[C@]2(CO2)C(C2(C)O[C@@H]2/C=C/C(C)C)[C@@H]1OC |
| InChI | InChI=1S/C22H37NO7/c1-15(2)6-7-17-21(3,30-17)19-18(26-5)16(8-9-22(19)14-28-22)29-20(24)23-10-11-27-13-12-25-4/h6-7,15-19H,8-14H2,1-5H3,(H,23,24)/b7-6+/t16-,17-,18-,19?,21?,22+/m1/s1 |
| InChIKey | LNVZECJTOPKRLP-YHZAZDEQSA-N |
| XLogP | 2.31 |
| TPSA | 91.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|