C21H33NO6 — CID 123271969
[5-methoxy-4-[2-methyl-3-(3-methylbut-1-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-hydroxy-3-methylazetidine-1-carboxylate (PubChem CID 123271969) has the molecular formula C21H33NO6 and a molecular weight of 395.50 g/mol. Its IUPAC name is [5-methoxy-4-[2-methyl-3-(3-methylbut-1-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-hydroxy-3-methylazetidine-1-carboxylate.
| Compound Name | [5-methoxy-4-[2-methyl-3-(3-methylbut-1-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-hydroxy-3-methylazetidine-1-carboxylate |
|---|---|
| PubChem CID | 123271969 |
| Molecular Formula | C21H33NO6 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | [5-methoxy-4-[2-methyl-3-(3-methylbut-1-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl] 3-hydroxy-3-methylazetidine-1-carboxylate |
| SMILES | COC1C(OC(=O)N2CC(C)(O)C2)CCC2(CO2)C1C1(C)OC1C=CC(C)C |
| InChI | InChI=1S/C21H33NO6/c1-13(2)6-7-15-20(4,28-15)17-16(25-5)14(8-9-21(17)12-26-21)27-18(23)22-10-19(3,24)11-22/h6-7,13-17,24H,8-12H2,1-5H3 |
| InChIKey | KQOGURDVIHCKDQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|