C12H11NO7 — CID 118063076
(2,5-dioxopyrrolidin-1-yl) 3-(4-methyl-2,5-dioxofuran-3-yl)propanoate (PubChem CID 118063076) has the molecular formula C12H11NO7 and a molecular weight of 281.22 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-(4-methyl-2,5-dioxofuran-3-yl)propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-(4-methyl-2,5-dioxofuran-3-yl)propanoate |
|---|---|
| PubChem CID | 118063076 |
| Molecular Formula | C12H11NO7 |
| Molecular Weight | 281.22 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-(4-methyl-2,5-dioxofuran-3-yl)propanoate |
| SMILES | CC1=C(CCC(=O)ON2C(=O)CCC2=O)C(=O)OC1=O |
| InChI | InChI=1S/C12H11NO7/c1-6-7(12(18)19-11(6)17)2-5-10(16)20-13-8(14)3-4-9(13)15/h2-5H2,1H3 |
| InChIKey | LSZZJVWSEOVRNO-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.22 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|