C17H23NO4 — CID 158325383
(2,5-dioxopyrrolidin-1-yl) 3-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)propanoate (PubChem CID 158325383) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)propanoate |
|---|---|
| PubChem CID | 158325383 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)propanoate |
| SMILES | CC1=C(C)C(C)(CCC(=O)ON2C(=O)CCC2=O)C(C)=C1C |
| InChI | InChI=1S/C17H23NO4/c1-10-11(2)13(4)17(5,12(10)3)9-8-16(21)22-18-14(19)6-7-15(18)20/h6-9H2,1-5H3 |
| InChIKey | GPILSNFSIIMQFW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|