C13H21N3O4 — CID 175418274
(2,5-dioxopyrrolidin-1-yl) 3-(3-methyldiazepan-3-yl)propanoate (PubChem CID 175418274) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-(3-methyldiazepan-3-yl)propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-(3-methyldiazepan-3-yl)propanoate |
|---|---|
| PubChem CID | 175418274 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-(3-methyldiazepan-3-yl)propanoate |
| SMILES | CC1(CCC(=O)ON2C(=O)CCC2=O)CCCCNN1 |
| InChI | InChI=1S/C13H21N3O4/c1-13(7-2-3-9-14-15-13)8-6-12(19)20-16-10(17)4-5-11(16)18/h14-15H,2-9H2,1H3 |
| InChIKey | FNVSJAIEIYFBGT-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|