C17H12FN5OS — CID 118064709
2-(4-cyanophenyl)-N'-(6-fluoro-3-pyridinyl)-4-methyl-1,3-thiazole-5-carbohydrazide (PubChem CID 118064709) has the molecular formula C17H12FN5OS and a molecular weight of 353.38 g/mol. Its IUPAC name is 2-(4-cyanophenyl)-N'-(6-fluoro-3-pyridinyl)-4-methyl-1,3-thiazole-5-carbohydrazide.
| Compound Name | 2-(4-cyanophenyl)-N'-(6-fluoro-3-pyridinyl)-4-methyl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 118064709 |
| Molecular Formula | C17H12FN5OS |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 2-(4-cyanophenyl)-N'-(6-fluoro-3-pyridinyl)-4-methyl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(-c2ccc(C#N)cc2)sc1C(=O)NNc1ccc(F)nc1 |
| InChI | InChI=1S/C17H12FN5OS/c1-10-15(16(24)23-22-13-6-7-14(18)20-9-13)25-17(21-10)12-4-2-11(8-19)3-5-12/h2-7,9,22H,1H3,(H,23,24) |
| InChIKey | FCZOFGKOXUCCSK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|