C15H20O7S — CID 118068734
2-[(1,2,3-trimethyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl)oxy]prop-2-enyl prop-2-enoate (PubChem CID 118068734) has the molecular formula C15H20O7S and a molecular weight of 344.39 g/mol. Its IUPAC name is 2-[(1,2,3-trimethyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl)oxy]prop-2-enyl prop-2-enoate.
| Compound Name | 2-[(1,2,3-trimethyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl)oxy]prop-2-enyl prop-2-enoate |
|---|---|
| PubChem CID | 118068734 |
| Molecular Formula | C15H20O7S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 2-[(1,2,3-trimethyl-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl)oxy]prop-2-enyl prop-2-enoate |
| SMILES | C=CC(=O)OCC(=C)OC1C2C3OC1(C)C(C)C3(C)OS2(=O)=O |
| InChI | InChI=1S/C15H20O7S/c1-6-10(16)19-7-8(2)20-12-11-13-15(5,22-23(11,17)18)9(3)14(12,4)21-13/h6,9,11-13H,1-2,7H2,3-5H3 |
| InChIKey | FPEGARAYHJMUNI-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|