C12H10BrClO4 — CID 118070679
2-bromo-1-(5-chloro-4,6-dimethoxy-1-benzofuran-2-yl)ethanone (PubChem CID 118070679) has the molecular formula C12H10BrClO4 and a molecular weight of 333.57 g/mol. Its IUPAC name is 2-bromo-1-(5-chloro-4,6-dimethoxy-1-benzofuran-2-yl)ethanone.
| Compound Name | 2-bromo-1-(5-chloro-4,6-dimethoxy-1-benzofuran-2-yl)ethanone |
|---|---|
| PubChem CID | 118070679 |
| Molecular Formula | C12H10BrClO4 |
| Molecular Weight | 333.57 g/mol |
| Exact Mass | 331.95 |
| IUPAC Name | 2-bromo-1-(5-chloro-4,6-dimethoxy-1-benzofuran-2-yl)ethanone |
| SMILES | COc1cc2oc(C(=O)CBr)cc2c(OC)c1Cl |
| InChI | InChI=1S/C12H10BrClO4/c1-16-10-4-8-6(12(17-2)11(10)14)3-9(18-8)7(15)5-13/h3-4H,5H2,1-2H3 |
| InChIKey | PUYCPVVXNMAXBR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.57 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|