C19H16F4N4O — CID 118071427
2-(difluoromethyl)-5-[(5S,8S)-3-(2,6-difluorophenyl)-5,8-dimethyl-6,7-dihydro-5H-cinnolin-8-yl]-1,3,4-oxadiazole (PubChem CID 118071427) has the molecular formula C19H16F4N4O and a molecular weight of 392.36 g/mol. Its IUPAC name is 2-(difluoromethyl)-5-[(5S,8S)-3-(2,6-difluorophenyl)-5,8-dimethyl-6,7-dihydro-5H-cinnolin-8-yl]-1,3,4-oxadiazole.
| Compound Name | 2-(difluoromethyl)-5-[(5S,8S)-3-(2,6-difluorophenyl)-5,8-dimethyl-6,7-dihydro-5H-cinnolin-8-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 118071427 |
| Molecular Formula | C19H16F4N4O |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 2-(difluoromethyl)-5-[(5S,8S)-3-(2,6-difluorophenyl)-5,8-dimethyl-6,7-dihydro-5H-cinnolin-8-yl]-1,3,4-oxadiazole |
| SMILES | C[C@H]1CC[C@](C)(c2nnc(C(F)F)o2)c2nnc(-c3c(F)cccc3F)cc21 |
| InChI | InChI=1S/C19H16F4N4O/c1-9-6-7-19(2,18-27-26-17(28-18)16(22)23)15-10(9)8-13(24-25-15)14-11(20)4-3-5-12(14)21/h3-5,8-9,16H,6-7H2,1-2H3/t9-,19-/m0/s1 |
| InChIKey | NMPSHJGKBPQDFI-UGZDLDLSSA-N |
| XLogP | 4.95 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |