C20H18F2N4O2 — CID 134545823
5-[(8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-3-methyl-1,3,4-oxadiazol-2-one (PubChem CID 134545823) has the molecular formula C20H18F2N4O2 and a molecular weight of 384.39 g/mol. Its IUPAC name is 5-[(8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-3-methyl-1,3,4-oxadiazol-2-one.
| Compound Name | 5-[(8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-3-methyl-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 134545823 |
| Molecular Formula | C20H18F2N4O2 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 5-[(8R)-5-(2,6-difluorophenyl)-11,11-dimethyl-3,4-diazatricyclo[6.2.1.02,7]undeca-2,4,6-trien-1-yl]-3-methyl-1,3,4-oxadiazol-2-one |
| SMILES | Cn1nc(C23CC[C@@H](c4cc(-c5c(F)cccc5F)nnc42)C3(C)C)oc1=O |
| InChI | InChI=1S/C20H18F2N4O2/c1-19(2)11-7-8-20(19,17-25-26(3)18(27)28-17)16-10(11)9-14(23-24-16)15-12(21)5-4-6-13(15)22/h4-6,9,11H,7-8H2,1-3H3/t11-,20?/m0/s1 |
| InChIKey | GDKIGFGZQDHERH-ZOZMEPSFSA-N |
| XLogP | 3.31 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |