C15H28OSi — CID 11807166
[(2R,3aS,6aR)-6a-methyl-2,3,3a,4-tetrahydro-1H-pentalen-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11807166) has the molecular formula C15H28OSi and a molecular weight of 252.47 g/mol. Its IUPAC name is [(2R,3aS,6aR)-6a-methyl-2,3,3a,4-tetrahydro-1H-pentalen-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3aS,6aR)-6a-methyl-2,3,3a,4-tetrahydro-1H-pentalen-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11807166 |
| Molecular Formula | C15H28OSi |
| Molecular Weight | 252.47 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | [(2R,3aS,6aR)-6a-methyl-2,3,3a,4-tetrahydro-1H-pentalen-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H]2CC=C[C@]2(C)C1 |
| InChI | InChI=1S/C15H28OSi/c1-14(2,3)17(5,6)16-13-10-12-8-7-9-15(12,4)11-13/h7,9,12-13H,8,10-11H2,1-6H3/t12-,13+,15+/m0/s1 |
| InChIKey | YZTJNLQFVIELKN-GZBFAFLISA-N |
| XLogP | 4.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|