C30H60O2Si2 — CID 54162250
[6a-[3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloct-1-enyl]-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 54162250) has the molecular formula C30H60O2Si2 and a molecular weight of 508.98 g/mol. Its IUPAC name is [6a-[3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloct-1-enyl]-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [6a-[3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloct-1-enyl]-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 54162250 |
| Molecular Formula | C30H60O2Si2 |
| Molecular Weight | 508.98 g/mol |
| Exact Mass | 508.41 |
| IUPAC Name | [6a-[3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloct-1-enyl]-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CCCCC(C)(C)C(C=CC12CCCC1CC(O[Si](C)(C)C(C)(C)C)C2)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H60O2Si2/c1-14-15-19-29(8,9)26(32-34(12,13)28(5,6)7)18-21-30-20-16-17-24(30)22-25(23-30)31-33(10,11)27(2,3)4/h18,21,24-26H,14-17,19-20,22-23H2,1-13H3 |
| InChIKey | OPGBAXWKBIYPLI-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.98 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|