C27H48OSi — CID 54155204
[(3S)-1-[(1S,3aS,4S,6aS)-4-but-3-enyl-5-methylidene-2,3,3a,4,6,6a-hexahydro-1H-pentalen-1-yl]oct-1-en-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 54155204) has the molecular formula C27H48OSi and a molecular weight of 416.77 g/mol. Its IUPAC name is [(3S)-1-[(1S,3aS,4S,6aS)-4-but-3-enyl-5-methylidene-2,3,3a,4,6,6a-hexahydro-1H-pentalen-1-yl]oct-1-en-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3S)-1-[(1S,3aS,4S,6aS)-4-but-3-enyl-5-methylidene-2,3,3a,4,6,6a-hexahydro-1H-pentalen-1-yl]oct-1-en-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 54155204 |
| Molecular Formula | C27H48OSi |
| Molecular Weight | 416.77 g/mol |
| Exact Mass | 416.35 |
| IUPAC Name | [(3S)-1-[(1S,3aS,4S,6aS)-4-but-3-enyl-5-methylidene-2,3,3a,4,6,6a-hexahydro-1H-pentalen-1-yl]oct-1-en-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=CCC[C@@H]1C(=C)C[C@@H]2[C@@H]1CC[C@H]2C=C[C@H](CCCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H48OSi/c1-9-11-13-14-23(28-29(7,8)27(4,5)6)18-16-22-17-19-25-24(15-12-10-2)21(3)20-26(22)25/h10,16,18,22-26H,2-3,9,11-15,17,19-20H2,1,4-8H3/t22-,23+,24-,25-,26+/m1/s1 |
| InChIKey | OKOHDFLAIDMYRN-OAQXCZEZSA-N |
| XLogP | 8.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.77 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|