C22H44O2Si2 — CID 46901140
[(2E)-2-[(3aS,6aR)-6a-triethylsilyloxy-2,3,3a,4,5,6-hexahydropentalen-1-ylidene]ethoxy]-tert-butyl-dimethylsilane (PubChem CID 46901140) has the molecular formula C22H44O2Si2 and a molecular weight of 396.76 g/mol. Its IUPAC name is [(2E)-2-[(3aS,6aR)-6a-triethylsilyloxy-2,3,3a,4,5,6-hexahydropentalen-1-ylidene]ethoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(2E)-2-[(3aS,6aR)-6a-triethylsilyloxy-2,3,3a,4,5,6-hexahydropentalen-1-ylidene]ethoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 46901140 |
| Molecular Formula | C22H44O2Si2 |
| Molecular Weight | 396.76 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | [(2E)-2-[(3aS,6aR)-6a-triethylsilyloxy-2,3,3a,4,5,6-hexahydropentalen-1-ylidene]ethoxy]-tert-butyl-dimethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@]12CCC[C@H]1CC/C2=C\CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H44O2Si2/c1-9-26(10-2,11-3)24-22-17-12-13-19(22)14-15-20(22)16-18-23-25(7,8)21(4,5)6/h16,19H,9-15,17-18H2,1-8H3/b20-16+/t19-,22+/m0/s1 |
| InChIKey | QLBHKCRFYDOECS-NRJSQGKVSA-N |
| XLogP | 7.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.76 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|