C30H60O2Si2 — CID 57193725
[6a-[(3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 57193725) has the molecular formula C30H60O2Si2 and a molecular weight of 508.98 g/mol. Its IUPAC name is [6a-[(3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [6a-[(3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 57193725 |
| Molecular Formula | C30H60O2Si2 |
| Molecular Weight | 508.98 g/mol |
| Exact Mass | 508.41 |
| IUPAC Name | [6a-[(3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methylnon-1-enyl]-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CCCC[C@@H](C)C[C@@H](C=CC12CCCC1CC(O[Si](C)(C)C(C)(C)C)C2)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H60O2Si2/c1-13-14-16-24(2)21-26(31-33(9,10)28(3,4)5)18-20-30-19-15-17-25(30)22-27(23-30)32-34(11,12)29(6,7)8/h18,20,24-27H,13-17,19,21-23H2,1-12H3/t24-,25?,26-,27?,30?/m1/s1 |
| InChIKey | VXGKBESGFGRUJB-ZBGPKHBYSA-N |
| XLogP | 10.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.98 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|