C30H58O2Si2 — CID 57299336
[6a-[4-[tert-butyl(dimethyl)silyl]oxy-4-ethenyloct-1-enyl]-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 57299336) has the molecular formula C30H58O2Si2 and a molecular weight of 506.96 g/mol. Its IUPAC name is [6a-[4-[tert-butyl(dimethyl)silyl]oxy-4-ethenyloct-1-enyl]-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [6a-[4-[tert-butyl(dimethyl)silyl]oxy-4-ethenyloct-1-enyl]-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 57299336 |
| Molecular Formula | C30H58O2Si2 |
| Molecular Weight | 506.96 g/mol |
| Exact Mass | 506.40 |
| IUPAC Name | [6a-[4-[tert-butyl(dimethyl)silyl]oxy-4-ethenyloct-1-enyl]-2,3,3a,4,5,6-hexahydro-1H-pentalen-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=CC(CC=CC12CCCC1CC(O[Si](C)(C)C(C)(C)C)C2)(CCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H58O2Si2/c1-13-15-21-30(14-2,32-34(11,12)28(6,7)8)22-17-20-29-19-16-18-25(29)23-26(24-29)31-33(9,10)27(3,4)5/h14,17,20,25-26H,2,13,15-16,18-19,21-24H2,1,3-12H3 |
| InChIKey | HCGZOVHOTKZIQQ-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.96 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|