C33H35N7O — CID 118071911
2-butyl-N-[3-[8-[4-(N,N'-dimethylcarbamimidoyl)anilino]imidazo[1,2-a]pyrazin-6-yl]-2-methylphenyl]benzamide (PubChem CID 118071911) has the molecular formula C33H35N7O and a molecular weight of 545.69 g/mol. Its IUPAC name is 2-butyl-N-[3-[8-[4-(N,N'-dimethylcarbamimidoyl)anilino]imidazo[1,2-a]pyrazin-6-yl]-2-methylphenyl]benzamide.
| Compound Name | 2-butyl-N-[3-[8-[4-(N,N'-dimethylcarbamimidoyl)anilino]imidazo[1,2-a]pyrazin-6-yl]-2-methylphenyl]benzamide |
|---|---|
| PubChem CID | 118071911 |
| Molecular Formula | C33H35N7O |
| Molecular Weight | 545.69 g/mol |
| Exact Mass | 545.29 |
| IUPAC Name | 2-butyl-N-[3-[8-[4-(N,N'-dimethylcarbamimidoyl)anilino]imidazo[1,2-a]pyrazin-6-yl]-2-methylphenyl]benzamide |
| SMILES | CCCCc1ccccc1C(=O)Nc1cccc(-c2cn3ccnc3c(Nc3ccc(/C(=N/C)NC)cc3)n2)c1C |
| InChI | InChI=1S/C33H35N7O/c1-5-6-10-23-11-7-8-12-27(23)33(41)39-28-14-9-13-26(22(28)2)29-21-40-20-19-36-32(40)31(38-29)37-25-17-15-24(16-18-25)30(34-3)35-4/h7-9,11-21H,5-6,10H2,1-4H3,(H,34,35)(H,37,38)(H,39,41) |
| InChIKey | HYDUPXMZXVZRFT-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.69 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|