C29H28FN5O4 — CID 174549037
2-butyl-N-[3-[6-(4-fluoro-3-nitroanilino)-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]benzamide (PubChem CID 174549037) has the molecular formula C29H28FN5O4 and a molecular weight of 529.57 g/mol. Its IUPAC name is 2-butyl-N-[3-[6-(4-fluoro-3-nitroanilino)-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]benzamide.
| Compound Name | 2-butyl-N-[3-[6-(4-fluoro-3-nitroanilino)-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]benzamide |
|---|---|
| PubChem CID | 174549037 |
| Molecular Formula | C29H28FN5O4 |
| Molecular Weight | 529.57 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | 2-butyl-N-[3-[6-(4-fluoro-3-nitroanilino)-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]benzamide |
| SMILES | CCCCc1ccccc1C(=O)Nc1cccc(-c2cn(C)c(=O)c(Nc3ccc(F)c([N+](=O)[O-])c3)n2)c1C |
| InChI | InChI=1S/C29H28FN5O4/c1-4-5-9-19-10-6-7-11-22(19)28(36)33-24-13-8-12-21(18(24)2)25-17-34(3)29(37)27(32-25)31-20-14-15-23(30)26(16-20)35(38)39/h6-8,10-17H,4-5,9H2,1-3H3,(H,31,32)(H,33,36) |
| InChIKey | VYHLEHBUQYOLQF-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.57 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|