C33H37FN6O4S — CID 175258599
2-butyl-N-[2-fluoro-3-[4-methyl-6-[4-(4-methylsulfonylpiperazin-1-yl)anilino]-5-oxopyrazin-2-yl]phenyl]benzamide (PubChem CID 175258599) has the molecular formula C33H37FN6O4S and a molecular weight of 632.76 g/mol. Its IUPAC name is 2-butyl-N-[2-fluoro-3-[4-methyl-6-[4-(4-methylsulfonylpiperazin-1-yl)anilino]-5-oxopyrazin-2-yl]phenyl]benzamide.
| Compound Name | 2-butyl-N-[2-fluoro-3-[4-methyl-6-[4-(4-methylsulfonylpiperazin-1-yl)anilino]-5-oxopyrazin-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 175258599 |
| Molecular Formula | C33H37FN6O4S |
| Molecular Weight | 632.76 g/mol |
| Exact Mass | 632.26 |
| IUPAC Name | 2-butyl-N-[2-fluoro-3-[4-methyl-6-[4-(4-methylsulfonylpiperazin-1-yl)anilino]-5-oxopyrazin-2-yl]phenyl]benzamide |
| SMILES | CCCCc1ccccc1C(=O)Nc1cccc(-c2cn(C)c(=O)c(Nc3ccc(N4CCN(S(C)(=O)=O)CC4)cc3)n2)c1F |
| InChI | InChI=1S/C33H37FN6O4S/c1-4-5-9-23-10-6-7-11-26(23)32(41)37-28-13-8-12-27(30(28)34)29-22-38(2)33(42)31(36-29)35-24-14-16-25(17-15-24)39-18-20-40(21-19-39)45(3,43)44/h6-8,10-17,22H,4-5,9,18-21H2,1-3H3,(H,35,36)(H,37,41) |
| InChIKey | HJJUUKIQYAXMNM-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 116.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.76 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|