C29H29N5O4 — CID 174563976
2-butyl-N-[2-methyl-3-[4-methyl-6-(4-nitroanilino)-5-oxopyrazin-2-yl]phenyl]benzamide (PubChem CID 174563976) has the molecular formula C29H29N5O4 and a molecular weight of 511.58 g/mol. Its IUPAC name is 2-butyl-N-[2-methyl-3-[4-methyl-6-(4-nitroanilino)-5-oxopyrazin-2-yl]phenyl]benzamide.
| Compound Name | 2-butyl-N-[2-methyl-3-[4-methyl-6-(4-nitroanilino)-5-oxopyrazin-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 174563976 |
| Molecular Formula | C29H29N5O4 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | 2-butyl-N-[2-methyl-3-[4-methyl-6-(4-nitroanilino)-5-oxopyrazin-2-yl]phenyl]benzamide |
| SMILES | CCCCc1ccccc1C(=O)Nc1cccc(-c2cn(C)c(=O)c(Nc3ccc([N+](=O)[O-])cc3)n2)c1C |
| InChI | InChI=1S/C29H29N5O4/c1-4-5-9-20-10-6-7-11-24(20)28(35)32-25-13-8-12-23(19(25)2)26-18-33(3)29(36)27(31-26)30-21-14-16-22(17-15-21)34(37)38/h6-8,10-18H,4-5,9H2,1-3H3,(H,30,31)(H,32,35) |
| InChIKey | AYWANTUDQCKXIK-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|