C28H29N5O3 — CID 174549002
2-butyl-N-[3-[6-[(1-hydroxy-4-pyridinylidene)amino]-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]benzamide (PubChem CID 174549002) has the molecular formula C28H29N5O3 and a molecular weight of 483.57 g/mol. Its IUPAC name is 2-butyl-N-[3-[6-[(1-hydroxy-4-pyridinylidene)amino]-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]benzamide.
| Compound Name | 2-butyl-N-[3-[6-[(1-hydroxy-4-pyridinylidene)amino]-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]benzamide |
|---|---|
| PubChem CID | 174549002 |
| Molecular Formula | C28H29N5O3 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 2-butyl-N-[3-[6-[(1-hydroxy-4-pyridinylidene)amino]-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]benzamide |
| SMILES | CCCCc1ccccc1C(=O)Nc1cccc(-c2cn(C)c(=O)c(N=c3ccn(O)cc3)n2)c1C |
| InChI | InChI=1S/C28H29N5O3/c1-4-5-9-20-10-6-7-11-23(20)27(34)31-24-13-8-12-22(19(24)2)25-18-32(3)28(35)26(30-25)29-21-14-16-33(36)17-15-21/h6-8,10-18,36H,4-5,9H2,1-3H3,(H,31,34) |
| InChIKey | PWYWYOIEUGXQPU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|