C20H21N5O3S — CID 118072057
3-[(3-methylsulfanyl-1-phenylindazol-6-yl)carbamoylamino]pyrrolidine-1-carboxylic acid (PubChem CID 118072057) has the molecular formula C20H21N5O3S and a molecular weight of 411.49 g/mol. Its IUPAC name is 3-[(3-methylsulfanyl-1-phenylindazol-6-yl)carbamoylamino]pyrrolidine-1-carboxylic acid.
| Compound Name | 3-[(3-methylsulfanyl-1-phenylindazol-6-yl)carbamoylamino]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 118072057 |
| Molecular Formula | C20H21N5O3S |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 3-[(3-methylsulfanyl-1-phenylindazol-6-yl)carbamoylamino]pyrrolidine-1-carboxylic acid |
| SMILES | CSc1nn(-c2ccccc2)c2cc(NC(=O)NC3CCN(C(=O)O)C3)ccc12 |
| InChI | InChI=1S/C20H21N5O3S/c1-29-18-16-8-7-13(11-17(16)25(23-18)15-5-3-2-4-6-15)21-19(26)22-14-9-10-24(12-14)20(27)28/h2-8,11,14H,9-10,12H2,1H3,(H,27,28)(H2,21,22,26) |
| InChIKey | LMMLDSFLTXTCFC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |