C20H24ClN5OS — CID 67448261
1-(3-methylsulfanyl-1-phenylindazol-6-yl)-3-piperidin-4-ylurea;hydrochloride (PubChem CID 67448261) has the molecular formula C20H24ClN5OS and a molecular weight of 417.97 g/mol. Its IUPAC name is 1-(3-methylsulfanyl-1-phenylindazol-6-yl)-3-piperidin-4-ylurea;hydrochloride.
| Compound Name | 1-(3-methylsulfanyl-1-phenylindazol-6-yl)-3-piperidin-4-ylurea;hydrochloride |
|---|---|
| PubChem CID | 67448261 |
| Molecular Formula | C20H24ClN5OS |
| Molecular Weight | 417.97 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 1-(3-methylsulfanyl-1-phenylindazol-6-yl)-3-piperidin-4-ylurea;hydrochloride |
| SMILES | CSc1nn(-c2ccccc2)c2cc(NC(=O)NC3CCNCC3)ccc12.Cl |
| InChI | InChI=1S/C20H23N5OS.ClH/c1-27-19-17-8-7-15(23-20(26)22-14-9-11-21-12-10-14)13-18(17)25(24-19)16-5-3-2-4-6-16;/h2-8,13-14,21H,9-12H2,1H3,(H2,22,23,26);1H |
| InChIKey | PXZOSAUAWFUQMN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.97 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |