C13H20O5 — CID 11807282
dimethyl 2-[(E)-6-hydroxy-5-methyl-2-methylidenehex-4-enyl]propanedioate (PubChem CID 11807282) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is dimethyl 2-[(E)-6-hydroxy-5-methyl-2-methylidenehex-4-enyl]propanedioate.
| Compound Name | dimethyl 2-[(E)-6-hydroxy-5-methyl-2-methylidenehex-4-enyl]propanedioate |
|---|---|
| PubChem CID | 11807282 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | dimethyl 2-[(E)-6-hydroxy-5-methyl-2-methylidenehex-4-enyl]propanedioate |
| SMILES | C=C(C/C=C(\C)CO)CC(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C13H20O5/c1-9(5-6-10(2)8-14)7-11(12(15)17-3)13(16)18-4/h6,11,14H,1,5,7-8H2,2-4H3/b10-6+ |
| InChIKey | ZLTRWYFVYWCWOY-UXBLZVDNSA-N |
| XLogP | 1.22 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|