C16H28O3 — CID 162413241
methyl (3S,6E,10E)-12-hydroxy-3,7,11-trimethyldodeca-6,10-dienoate (PubChem CID 162413241) has the molecular formula C16H28O3 and a molecular weight of 268.40 g/mol. Its IUPAC name is methyl (3S,6E,10E)-12-hydroxy-3,7,11-trimethyldodeca-6,10-dienoate.
| Compound Name | methyl (3S,6E,10E)-12-hydroxy-3,7,11-trimethyldodeca-6,10-dienoate |
|---|---|
| PubChem CID | 162413241 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | methyl (3S,6E,10E)-12-hydroxy-3,7,11-trimethyldodeca-6,10-dienoate |
| SMILES | COC(=O)C[C@@H](C)CC/C=C(\C)CC/C=C(\C)CO |
| InChI | InChI=1S/C16H28O3/c1-13(8-6-10-15(3)12-17)7-5-9-14(2)11-16(18)19-4/h7,10,14,17H,5-6,8-9,11-12H2,1-4H3/b13-7+,15-10+/t14-/m0/s1 |
| InChIKey | VWXPADYCTHGTGK-MNNUHKGNSA-N |
| XLogP | 3.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|