C25H22O2 — CID 118073293
2-[(1S,2S)-2-benzyl-1-hydroxy-1,3-dihydroinden-2-yl]-1H-inden-1-ol (PubChem CID 118073293) has the molecular formula C25H22O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 2-[(1S,2S)-2-benzyl-1-hydroxy-1,3-dihydroinden-2-yl]-1H-inden-1-ol.
| Compound Name | 2-[(1S,2S)-2-benzyl-1-hydroxy-1,3-dihydroinden-2-yl]-1H-inden-1-ol |
|---|---|
| PubChem CID | 118073293 |
| Molecular Formula | C25H22O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 2-[(1S,2S)-2-benzyl-1-hydroxy-1,3-dihydroinden-2-yl]-1H-inden-1-ol |
| SMILES | OC1C([C@]2(Cc3ccccc3)Cc3ccccc3[C@H]2O)=Cc2ccccc21 |
| InChI | InChI=1S/C25H22O2/c26-23-20-12-6-4-10-18(20)14-22(23)25(15-17-8-2-1-3-9-17)16-19-11-5-7-13-21(19)24(25)27/h1-14,23-24,26-27H,15-16H2/t23?,24-,25+/m1/s1 |
| InChIKey | KNLMYVTXBOLCKN-ZQWZXOJDSA-N |
| XLogP | 4.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |