C16H11NO — CID 129391328
(2S)-2-hydroxytricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene-9-carbonitrile (PubChem CID 129391328) has the molecular formula C16H11NO and a molecular weight of 233.27 g/mol. Its IUPAC name is (2S)-2-hydroxytricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene-9-carbonitrile.
| Compound Name | (2S)-2-hydroxytricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene-9-carbonitrile |
|---|---|
| PubChem CID | 129391328 |
| Molecular Formula | C16H11NO |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | (2S)-2-hydroxytricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene-9-carbonitrile |
| SMILES | N#CC1=Cc2ccccc2[C@H](O)c2ccccc21 |
| InChI | InChI=1S/C16H11NO/c17-10-12-9-11-5-1-2-7-14(11)16(18)15-8-4-3-6-13(12)15/h1-9,16,18H/t16-/m0/s1 |
| InChIKey | ZECPMDJMKXSXIF-INIZCTEOSA-N |
| XLogP | 3.15 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|