C18H29N5O9S — CID 118073813
(2S)-2-tert-butyl-2-[[[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]carbamoyl]piperidine-1-carboxylic acid (PubChem CID 118073813) has the molecular formula C18H29N5O9S and a molecular weight of 491.52 g/mol. Its IUPAC name is (2S)-2-tert-butyl-2-[[[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]carbamoyl]piperidine-1-carboxylic acid.
| Compound Name | (2S)-2-tert-butyl-2-[[[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]carbamoyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 118073813 |
| Molecular Formula | C18H29N5O9S |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | (2S)-2-tert-butyl-2-[[[(2S,5R)-7-oxo-6-sulfooxy-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]carbamoyl]piperidine-1-carboxylic acid |
| SMILES | CC(C)(C)[C@]1(C(=O)NNC(=O)[C@@H]2CC[C@@H]3CN2C(=O)N3OS(=O)(=O)O)CCCCN1C(=O)O |
| InChI | InChI=1S/C18H29N5O9S/c1-17(2,3)18(8-4-5-9-22(18)16(27)28)14(25)20-19-13(24)12-7-6-11-10-21(12)15(26)23(11)32-33(29,30)31/h11-12H,4-10H2,1-3H3,(H,19,24)(H,20,25)(H,27,28)(H,29,30,31)/t11-,12+,18-/m1/s1 |
| InChIKey | CVYUIEWSRDQKGO-FTLABTOESA-N |
| XLogP | 0.09 |
| TPSA | 185.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|