C16H20O4 — CID 11807964
(1R,3aS,4S,7aR)-4-methyl-1-(phenylmethoxymethyl)-1,3,3a,4,7,7a-hexahydrofuro[3,4-c]pyran-6-one (PubChem CID 11807964) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is (1R,3aS,4S,7aR)-4-methyl-1-(phenylmethoxymethyl)-1,3,3a,4,7,7a-hexahydrofuro[3,4-c]pyran-6-one.
| Compound Name | (1R,3aS,4S,7aR)-4-methyl-1-(phenylmethoxymethyl)-1,3,3a,4,7,7a-hexahydrofuro[3,4-c]pyran-6-one |
|---|---|
| PubChem CID | 11807964 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (1R,3aS,4S,7aR)-4-methyl-1-(phenylmethoxymethyl)-1,3,3a,4,7,7a-hexahydrofuro[3,4-c]pyran-6-one |
| SMILES | C[C@@H]1OC(=O)C[C@@H]2[C@H]1CO[C@H]2COCc1ccccc1 |
| InChI | InChI=1S/C16H20O4/c1-11-14-9-19-15(13(14)7-16(17)20-11)10-18-8-12-5-3-2-4-6-12/h2-6,11,13-15H,7-10H2,1H3/t11-,13+,14-,15-/m0/s1 |
| InChIKey | DZTAPBNVCMYJRR-ATGSNQNLSA-N |
| XLogP | 2.17 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |