C30H35N3O8 — CID 118083328
3-[(6R,7S,8aR)-6-(3-amino-3-oxopropanoyl)-4,6,10-trihydroxy-7-(2-hydroxyethyl)-5-oxo-7,8,8a,9-tetrahydroanthracen-1-yl]-N-[2-(dimethylamino)ethyl]benzamide (PubChem CID 118083328) has the molecular formula C30H35N3O8 and a molecular weight of 565.62 g/mol. Its IUPAC name is 3-[(6R,7S,8aR)-6-(3-amino-3-oxopropanoyl)-4,6,10-trihydroxy-7-(2-hydroxyethyl)-5-oxo-7,8,8a,9-tetrahydroanthracen-1-yl]-N-[2-(dimethylamino)ethyl]benzamide.
| Compound Name | 3-[(6R,7S,8aR)-6-(3-amino-3-oxopropanoyl)-4,6,10-trihydroxy-7-(2-hydroxyethyl)-5-oxo-7,8,8a,9-tetrahydroanthracen-1-yl]-N-[2-(dimethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 118083328 |
| Molecular Formula | C30H35N3O8 |
| Molecular Weight | 565.62 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | 3-[(6R,7S,8aR)-6-(3-amino-3-oxopropanoyl)-4,6,10-trihydroxy-7-(2-hydroxyethyl)-5-oxo-7,8,8a,9-tetrahydroanthracen-1-yl]-N-[2-(dimethylamino)ethyl]benzamide |
| SMILES | CN(C)CCNC(=O)c1cccc(-c2ccc(O)c3c2C[C@H]2C[C@@H](CCO)[C@@](O)(C(=O)CC(N)=O)C(=O)C2=C3O)c1 |
| InChI | InChI=1S/C30H35N3O8/c1-33(2)10-9-32-29(40)17-5-3-4-16(12-17)20-6-7-22(35)26-21(20)14-18-13-19(8-11-34)30(41,23(36)15-24(31)37)28(39)25(18)27(26)38/h3-7,12,18-19,34-35,38,41H,8-11,13-15H2,1-2H3,(H2,31,37)(H,32,40)/t18-,19-,30-/m1/s1 |
| InChIKey | NBXPMKNVXUVKDA-FWIXPWDUSA-N |
| XLogP | 0.94 |
| TPSA | 190.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.62 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|