C23H31NO8 — CID 158551849
3-[(2R,3S,4aR)-2,8,9-trihydroxy-3-(2-hydroxyethyl)-5-methyl-1-oxo-3,4,4a,10-tetrahydroanthracen-2-yl]-3-oxopropanamide;propan-2-ol (PubChem CID 158551849) has the molecular formula C23H31NO8 and a molecular weight of 449.50 g/mol. Its IUPAC name is 3-[(2R,3S,4aR)-2,8,9-trihydroxy-3-(2-hydroxyethyl)-5-methyl-1-oxo-3,4,4a,10-tetrahydroanthracen-2-yl]-3-oxopropanamide;propan-2-ol.
| Compound Name | 3-[(2R,3S,4aR)-2,8,9-trihydroxy-3-(2-hydroxyethyl)-5-methyl-1-oxo-3,4,4a,10-tetrahydroanthracen-2-yl]-3-oxopropanamide;propan-2-ol |
|---|---|
| PubChem CID | 158551849 |
| Molecular Formula | C23H31NO8 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 3-[(2R,3S,4aR)-2,8,9-trihydroxy-3-(2-hydroxyethyl)-5-methyl-1-oxo-3,4,4a,10-tetrahydroanthracen-2-yl]-3-oxopropanamide;propan-2-ol |
| SMILES | CC(C)O.Cc1ccc(O)c2c1C[C@H]1C[C@@H](CCO)[C@@](O)(C(=O)CC(N)=O)C(=O)C1=C2O |
| InChI | InChI=1S/C20H23NO7.C3H8O/c1-9-2-3-13(23)17-12(9)7-10-6-11(4-5-22)20(28,14(24)8-15(21)25)19(27)16(10)18(17)26;1-3(2)4/h2-3,10-11,22-23,26,28H,4-8H2,1H3,(H2,21,25);3-4H,1-2H3/t10-,11-,20-;/m1./s1 |
| InChIKey | TYKMRCQXDGLYRD-MNOVCEDUSA-N |
| XLogP | 0.68 |
| TPSA | 178.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|